C11H21ClO — CID 2724987
(1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 2724987) has the molecular formula C11H21ClO and a molecular weight of 204.74 g/mol. Its IUPAC name is (1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 2724987 |
| Molecular Formula | C11H21ClO |
| Molecular Weight | 204.74 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCl |
| InChI | InChI=1S/C11H21ClO/c1-8(2)10-5-4-9(3)6-11(10)13-7-12/h8-11H,4-7H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | XOPLTFUYFXWFGB-OUAUKWLOSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|