C31H60O3Si — CID 101270451
methyl-tris[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]silane (PubChem CID 101270451) has the molecular formula C31H60O3Si and a molecular weight of 508.90 g/mol. Its IUPAC name is methyl-tris[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]silane.
| Compound Name | methyl-tris[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]silane |
|---|---|
| PubChem CID | 101270451 |
| Molecular Formula | C31H60O3Si |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | methyl-tris[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]silane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[Si](C)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C31H60O3Si/c1-20(2)26-14-11-23(7)17-29(26)32-35(10,33-30-18-24(8)12-15-27(30)21(3)4)34-31-19-25(9)13-16-28(31)22(5)6/h20-31H,11-19H2,1-10H3/t23-,24-,25-,26+,27+,28+,29-,30-,31-/m1/s1 |
| InChIKey | VVLZDUWLUGVKGX-OYQLFMJPSA-N |
| XLogP | 8.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|