C19H32OSi — CID 586507
ethyl-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylsilane (PubChem CID 586507) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is ethyl-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylsilane.
| Compound Name | ethyl-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylsilane |
|---|---|
| PubChem CID | 586507 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | ethyl-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylsilane |
| SMILES | CC[Si](C)(OC1CC(C)CCC1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H32OSi/c1-6-21(5,17-10-8-7-9-11-17)20-19-14-16(4)12-13-18(19)15(2)3/h7-11,15-16,18-19H,6,12-14H2,1-5H3 |
| InChIKey | TTZROUGQVRLHHM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|