C19H31FOSi — CID 593339
ethyl-(4-fluorophenyl)-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxysilane (PubChem CID 593339) has the molecular formula C19H31FOSi and a molecular weight of 322.54 g/mol. Its IUPAC name is ethyl-(4-fluorophenyl)-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxysilane.
| Compound Name | ethyl-(4-fluorophenyl)-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxysilane |
|---|---|
| PubChem CID | 593339 |
| Molecular Formula | C19H31FOSi |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | ethyl-(4-fluorophenyl)-methyl-(5-methyl-2-propan-2-ylcyclohexyl)oxysilane |
| SMILES | CC[Si](C)(OC1CC(C)CCC1C(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H31FOSi/c1-6-22(5,17-10-8-16(20)9-11-17)21-19-13-15(4)7-12-18(19)14(2)3/h8-11,14-15,18-19H,6-7,12-13H2,1-5H3 |
| InChIKey | TUDANWVKKCRNDY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|