C27H44FO2Si — CID 136740321
CID 136740321 (PubChem CID 136740321) has the molecular formula C27H44FO2Si and a molecular weight of 447.73 g/mol.
| Compound Name | CID 136740321 |
|---|---|
| PubChem CID | 136740321 |
| Molecular Formula | C27H44FO2Si |
| Molecular Weight | 447.73 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O[Si](Cc1ccc(F)cc1)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C27H44FO2Si/c1-18(2)24-13-7-20(5)15-26(24)29-31(17-22-9-11-23(28)12-10-22)30-27-16-21(6)8-14-25(27)19(3)4/h9-12,18-21,24-27H,7-8,13-17H2,1-6H3/t20-,21-,24+,25+,26-,27-/m0/s1 |
| InChIKey | HYOPFWORQJEQID-QIICVMLZSA-N |
| XLogP | 7.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.73 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|