C17H25ClO — CID 178071017
1-(chloromethyl)-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxybenzene (PubChem CID 178071017) has the molecular formula C17H25ClO and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-(chloromethyl)-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxybenzene.
| Compound Name | 1-(chloromethyl)-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxybenzene |
|---|---|
| PubChem CID | 178071017 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(chloromethyl)-4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxybenzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1Oc1ccc(CCl)cc1 |
| InChI | InChI=1S/C17H25ClO/c1-12(2)16-9-4-13(3)10-17(16)19-15-7-5-14(11-18)6-8-15/h5-8,12-13,16-17H,4,9-11H2,1-3H3/t13-,16+,17-/m1/s1 |
| InChIKey | MJYBMPGYVWJKCF-XOKHGSTOSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|