C24H35NO — CID 146331816
N-[[6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynaphthalen-2-yl]methyl]propan-1-amine (PubChem CID 146331816) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is N-[[6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynaphthalen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynaphthalen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 146331816 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | N-[[6-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynaphthalen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc2cc(O[C@@H]3C[C@H](C)CC[C@H]3C(C)C)ccc2c1 |
| InChI | InChI=1S/C24H35NO/c1-5-12-25-16-19-7-8-21-15-22(10-9-20(21)14-19)26-24-13-18(4)6-11-23(24)17(2)3/h7-10,14-15,17-18,23-25H,5-6,11-13,16H2,1-4H3/t18-,23+,24-/m1/s1 |
| InChIKey | MOEGDPDSNNWCEG-PUZWTLIVSA-N |
| XLogP | 6.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|