C18H26O4 — CID 166450076
2-hydroxy-2-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxyphenyl]acetic acid (PubChem CID 166450076) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-hydroxy-2-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxyphenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 166450076 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-hydroxy-2-[4-(5-methyl-2-propan-2-ylcyclohexyl)oxyphenyl]acetic acid |
| SMILES | CC1CCC(C(C)C)C(Oc2ccc(C(O)C(=O)O)cc2)C1 |
| InChI | InChI=1S/C18H26O4/c1-11(2)15-9-4-12(3)10-16(15)22-14-7-5-13(6-8-14)17(19)18(20)21/h5-8,11-12,15-17,19H,4,9-10H2,1-3H3,(H,20,21) |
| InChIKey | NVYWBHKTQRMMOF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |