C27H34O3 — CID 102316941
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbut-2-enoate (PubChem CID 102316941) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbut-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbut-2-enoate |
|---|---|
| PubChem CID | 102316941 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (E)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbut-2-enoate |
| SMILES | C/C(=C(\C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34O3/c1-18(2)23-16-15-19(3)17-24(23)30-27(29)25(20(4)21-11-7-5-8-12-21)26(28)22-13-9-6-10-14-22/h5-14,18-19,23-24,26,28H,15-17H2,1-4H3/b25-20+/t19-,23+,24-,26-/m1/s1 |
| InChIKey | UZPTXPNRUXDKGK-NNTUNXQWSA-N |
| XLogP | 6.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|