C26H29NO2 — CID 18469616
(5-methyl-2-propan-2-ylcyclohexyl) 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 18469616) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 18469616 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C(C#N)=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H29NO2/c1-18(2)22-15-14-19(3)16-24(22)29-26(28)23(17-27)25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,18-19,22,24H,14-16H2,1-3H3 |
| InChIKey | FGTGOFIQKUHORR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|