C22H24CrO6 — CID 10917101
carbon monoxide;[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylmethylidene]chromium (PubChem CID 10917101) has the molecular formula C22H24CrO6 and a molecular weight of 436.42 g/mol. Its IUPAC name is carbon monoxide;[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylmethylidene]chromium.
| Compound Name | carbon monoxide;[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylmethylidene]chromium |
|---|---|
| PubChem CID | 10917101 |
| Molecular Formula | C22H24CrO6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | carbon monoxide;[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylmethylidene]chromium |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=[Cr])c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C17H24O.5CO.Cr/c1-13(2)16-10-9-14(3)11-17(16)18-12-15-7-5-4-6-8-15;5*1-2;/h4-8,13-14,16-17H,9-11H2,1-3H3;;;;;;/t14-,16+,17-;;;;;;/m1....../s1 |
| InChIKey | CJZUEFLQSWRJHA-BYTSYKIISA-N |
| XLogP | 4.00 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|