C14H22O2 — CID 71368513
2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyfuran (PubChem CID 71368513) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyfuran.
| Compound Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyfuran |
|---|---|
| PubChem CID | 71368513 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyfuran |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1Oc1ccco1 |
| InChI | InChI=1S/C14H22O2/c1-10(2)12-7-6-11(3)9-13(12)16-14-5-4-8-15-14/h4-5,8,10-13H,6-7,9H2,1-3H3/t11-,12+,13-/m1/s1 |
| InChIKey | LSHANDNGTRHRNJ-FRRDWIJNSA-N |
| XLogP | 4.12 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |