C15H26O — CID 117070570
CID 117070570 (PubChem CID 117070570) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol.
| Compound Name | CID 117070570 |
|---|---|
| PubChem CID | 117070570 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O[C]1[CH]CCC1 |
| InChI | InChI=1S/C15H26O/c1-11(2)14-9-8-12(3)10-15(14)16-13-6-4-5-7-13/h6,11-12,14-15H,4-5,7-10H2,1-3H3/t12-,14+,15+/m1/s1 |
| InChIKey | DZTTWXYWKGPNHH-SNPRPXQTSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |