C10H20O2P- — CID 101185774
(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinite (PubChem CID 101185774) has the molecular formula C10H20O2P- and a molecular weight of 203.24 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinite.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinite |
|---|---|
| PubChem CID | 101185774 |
| Molecular Formula | C10H20O2P- |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinite |
| SMILES | CC1CCC(C(C)C)C(OP[O-])C1 |
| InChI | InChI=1S/C10H20O2P/c1-7(2)9-5-4-8(3)6-10(9)12-13-11/h7-10,13H,4-6H2,1-3H3/q-1 |
| InChIKey | NXDOELFPBPLVSH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|