C14H22O3S — CID 10978536
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (R)-furan-2-sulfinate (PubChem CID 10978536) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (R)-furan-2-sulfinate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (R)-furan-2-sulfinate |
|---|---|
| PubChem CID | 10978536 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (R)-furan-2-sulfinate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[S@@](=O)c1ccco1 |
| InChI | InChI=1S/C14H22O3S/c1-10(2)12-7-6-11(3)9-13(12)17-18(15)14-5-4-8-16-14/h4-5,8,10-13H,6-7,9H2,1-3H3/t11-,12+,13-,18-/m1/s1 |
| InChIKey | CRYKEJHGJADNJI-SJBDTSRBSA-N |
| XLogP | 3.78 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |