C17H29NO2 — CID 62571265
N-(furan-2-ylmethyl)-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanamine (PubChem CID 62571265) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanamine |
|---|---|
| PubChem CID | 62571265 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanamine |
| SMILES | CC1CCC(C(C)C)C(OCCNCc2ccco2)C1 |
| InChI | InChI=1S/C17H29NO2/c1-13(2)16-7-6-14(3)11-17(16)20-10-8-18-12-15-5-4-9-19-15/h4-5,9,13-14,16-18H,6-8,10-12H2,1-3H3 |
| InChIKey | DCSHLEFTQRCPAE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|