C14H23NO2 — CID 62566530
N-(furan-2-ylmethyl)-2-(4-methylcyclohexyl)oxyethanamine (PubChem CID 62566530) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(4-methylcyclohexyl)oxyethanamine.
| Compound Name | N-(furan-2-ylmethyl)-2-(4-methylcyclohexyl)oxyethanamine |
|---|---|
| PubChem CID | 62566530 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(4-methylcyclohexyl)oxyethanamine |
| SMILES | CC1CCC(OCCNCc2ccco2)CC1 |
| InChI | InChI=1S/C14H23NO2/c1-12-4-6-13(7-5-12)17-10-8-15-11-14-3-2-9-16-14/h2-3,9,12-13,15H,4-8,10-11H2,1H3 |
| InChIKey | LUGPOTBAVHJNRU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|