C12H19NO3 — CID 115690981
N-(furan-2-ylmethyl)-3-(oxolan-3-yloxy)propan-1-amine (PubChem CID 115690981) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(oxolan-3-yloxy)propan-1-amine.
| Compound Name | N-(furan-2-ylmethyl)-3-(oxolan-3-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 115690981 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(oxolan-3-yloxy)propan-1-amine |
| SMILES | c1coc(CNCCCOC2CCOC2)c1 |
| InChI | InChI=1S/C12H19NO3/c1-3-11(15-6-1)9-13-5-2-7-16-12-4-8-14-10-12/h1,3,6,12-13H,2,4-5,7-10H2 |
| InChIKey | ZBGBIKXOWPKEMG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|