C18H24F2N2O3S — CID 90952184
(5-methyl-2-propan-2-ylcyclohexyl) 4-(difluoromethoxy)-1H-benzimidazole-2-sulfinate (PubChem CID 90952184) has the molecular formula C18H24F2N2O3S and a molecular weight of 386.46 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 4-(difluoromethoxy)-1H-benzimidazole-2-sulfinate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-(difluoromethoxy)-1H-benzimidazole-2-sulfinate |
|---|---|
| PubChem CID | 90952184 |
| Molecular Formula | C18H24F2N2O3S |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-(difluoromethoxy)-1H-benzimidazole-2-sulfinate |
| SMILES | CC1CCC(C(C)C)C(OS(=O)c2nc3c(OC(F)F)cccc3[nH]2)C1 |
| InChI | InChI=1S/C18H24F2N2O3S/c1-10(2)12-8-7-11(3)9-15(12)25-26(23)18-21-13-5-4-6-14(16(13)22-18)24-17(19)20/h4-6,10-12,15,17H,7-9H2,1-3H3,(H,21,22) |
| InChIKey | DKJDZHQKYBMSND-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |