C16H23IO2S — CID 134935222
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-iodobenzenesulfinate (PubChem CID 134935222) has the molecular formula C16H23IO2S and a molecular weight of 406.33 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-iodobenzenesulfinate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-iodobenzenesulfinate |
|---|---|
| PubChem CID | 134935222 |
| Molecular Formula | C16H23IO2S |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-iodobenzenesulfinate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OS(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H23IO2S/c1-11(2)15-9-4-12(3)10-16(15)19-20(18)14-7-5-13(17)6-8-14/h5-8,11-12,15-16H,4,9-10H2,1-3H3/t12-,15+,16-,20?/m1/s1 |
| InChIKey | FOPLDYUSMMWSDN-DYULYYJYSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|