C22H29O2PS — CID 132512875
[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylsulfanylphosphoryl]benzene (PubChem CID 132512875) has the molecular formula C22H29O2PS and a molecular weight of 388.51 g/mol. Its IUPAC name is [[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylsulfanylphosphoryl]benzene.
| Compound Name | [[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylsulfanylphosphoryl]benzene |
|---|---|
| PubChem CID | 132512875 |
| Molecular Formula | C22H29O2PS |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylsulfanylphosphoryl]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OP(=O)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29O2PS/c1-17(2)21-15-14-18(3)16-22(21)24-25(23,19-10-6-4-7-11-19)26-20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22-,25?/m1/s1 |
| InChIKey | KOUAAKUUHOURDQ-RBUVZMSVSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|