C21H33O2P — CID 11617205
[cyclopentyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene (PubChem CID 11617205) has the molecular formula C21H33O2P and a molecular weight of 348.47 g/mol. Its IUPAC name is [cyclopentyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene.
| Compound Name | [cyclopentyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene |
|---|---|
| PubChem CID | 11617205 |
| Molecular Formula | C21H33O2P |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [cyclopentyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[P@](=O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C21H33O2P/c1-16(2)20-14-13-17(3)15-21(20)23-24(22,19-11-7-8-12-19)18-9-5-4-6-10-18/h4-6,9-10,16-17,19-21H,7-8,11-15H2,1-3H3/t17-,20+,21-,24-/m1/s1 |
| InChIKey | WWRYXJUHIZDBCI-CXEBNRJLSA-N |
| XLogP | 6.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|