C19H32NO2P — CID 11907532
N-[[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine (PubChem CID 11907532) has the molecular formula C19H32NO2P and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine.
| Compound Name | N-[[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 11907532 |
| Molecular Formula | C19H32NO2P |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine |
| SMILES | CC(C)N[P@@](=O)(O[C@@H]1C[C@@H](C)CC[C@@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H32NO2P/c1-14(2)18-12-11-16(5)13-19(18)22-23(21,20-15(3)4)17-9-7-6-8-10-17/h6-10,14-16,18-19H,11-13H2,1-5H3,(H,20,21)/t16-,18+,19+,23-/m0/s1 |
| InChIKey | ADULCGJWFWMRGU-YIKPNSEUSA-N |
| XLogP | 4.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|