C24H34NO3P — CID 11914102
4-ethoxy-N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]aniline (PubChem CID 11914102) has the molecular formula C24H34NO3P and a molecular weight of 415.51 g/mol. Its IUPAC name is 4-ethoxy-N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]aniline.
| Compound Name | 4-ethoxy-N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]aniline |
|---|---|
| PubChem CID | 11914102 |
| Molecular Formula | C24H34NO3P |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-ethoxy-N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]aniline |
| SMILES | CCOc1ccc(N[P@](=O)(O[C@H]2C[C@H](C)CC[C@@H]2C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H34NO3P/c1-5-27-21-14-12-20(13-15-21)25-29(26,22-9-7-6-8-10-22)28-24-17-19(4)11-16-23(24)18(2)3/h6-10,12-15,18-19,23-24H,5,11,16-17H2,1-4H3,(H,25,26)/t19-,23-,24+,29-/m1/s1 |
| InChIKey | IRXPWPJDQDPAQU-XTVRUMMYSA-N |
| XLogP | 6.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|