C23H31O4P — CID 46702320
1-methoxy-4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxybenzene (PubChem CID 46702320) has the molecular formula C23H31O4P and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-methoxy-4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxybenzene.
| Compound Name | 1-methoxy-4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxybenzene |
|---|---|
| PubChem CID | 46702320 |
| Molecular Formula | C23H31O4P |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 1-methoxy-4-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxybenzene |
| SMILES | COc1ccc(O[P@](=O)(O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H31O4P/c1-17(2)22-15-10-18(3)16-23(22)27-28(24,21-8-6-5-7-9-21)26-20-13-11-19(25-4)12-14-20/h5-9,11-14,17-18,22-23H,10,15-16H2,1-4H3/t18-,22+,23-,28+/m1/s1 |
| InChIKey | ZNRVYKIWDUNGRA-CBBANLGTSA-N |
| XLogP | 6.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|