C35H54NO4P — CID 3343548
N-benzyl-1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-1-(4-methoxyphenyl)methanamine (PubChem CID 3343548) has the molecular formula C35H54NO4P and a molecular weight of 583.79 g/mol. Its IUPAC name is N-benzyl-1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-1-(4-methoxyphenyl)methanamine.
| Compound Name | N-benzyl-1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-1-(4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 3343548 |
| Molecular Formula | C35H54NO4P |
| Molecular Weight | 583.79 g/mol |
| Exact Mass | 583.38 |
| IUPAC Name | N-benzyl-1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-1-(4-methoxyphenyl)methanamine |
| SMILES | COc1ccc(C(NCc2ccccc2)P(=O)(OC2CC(C)CCC2C(C)C)OC2CC(C)CCC2C(C)C)cc1 |
| InChI | InChI=1S/C35H54NO4P/c1-24(2)31-19-13-26(5)21-33(31)39-41(37,40-34-22-27(6)14-20-32(34)25(3)4)35(29-15-17-30(38-7)18-16-29)36-23-28-11-9-8-10-12-28/h8-12,15-18,24-27,31-36H,13-14,19-23H2,1-7H3 |
| InChIKey | MTRCMXSXBNSWIM-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.79 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|