C34H48BrO5P — CID 124774585
[(R)-(4-bromophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methyl] benzoate (PubChem CID 124774585) has the molecular formula C34H48BrO5P and a molecular weight of 647.63 g/mol. Its IUPAC name is [(R)-(4-bromophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methyl] benzoate.
| Compound Name | [(R)-(4-bromophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methyl] benzoate |
|---|---|
| PubChem CID | 124774585 |
| Molecular Formula | C34H48BrO5P |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | [(R)-(4-bromophenyl)-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]methyl] benzoate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OP(=O)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)[C@@H](OC(=O)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C34H48BrO5P/c1-22(2)29-18-12-24(5)20-31(29)39-41(37,40-32-21-25(6)13-19-30(32)23(3)4)34(27-14-16-28(35)17-15-27)38-33(36)26-10-8-7-9-11-26/h7-11,14-17,22-25,29-32,34H,12-13,18-21H2,1-6H3/t24-,25-,29-,30+,31-,32-,34-,41?/m1/s1 |
| InChIKey | IDYAKPSZJHEKMQ-OWRQBTEVSA-N |
| XLogP | 10.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|