C34H48BrO5PS — CID 4073480
[bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-(4-bromophenyl)methyl] 3-thiophen-2-ylprop-2-enoate (PubChem CID 4073480) has the molecular formula C34H48BrO5PS and a molecular weight of 679.70 g/mol. Its IUPAC name is [bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-(4-bromophenyl)methyl] 3-thiophen-2-ylprop-2-enoate.
| Compound Name | [bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-(4-bromophenyl)methyl] 3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 4073480 |
| Molecular Formula | C34H48BrO5PS |
| Molecular Weight | 679.70 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | [bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]phosphoryl-(4-bromophenyl)methyl] 3-thiophen-2-ylprop-2-enoate |
| SMILES | CC1CCC(C(C)C)C(OP(=O)(OC2CC(C)CCC2C(C)C)C(OC(=O)C=Cc2cccs2)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C34H48BrO5PS/c1-22(2)29-16-9-24(5)20-31(29)39-41(37,40-32-21-25(6)10-17-30(32)23(3)4)34(26-11-13-27(35)14-12-26)38-33(36)18-15-28-8-7-19-42-28/h7-8,11-15,18-19,22-25,29-32,34H,9-10,16-17,20-21H2,1-6H3 |
| InChIKey | UGQKVDJWYMWAJD-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.70 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|