C33H48NO5PS — CID 129449375
[(R)-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (Z)-3-thiophen-2-ylprop-2-enoate (PubChem CID 129449375) has the molecular formula C33H48NO5PS and a molecular weight of 601.79 g/mol. Its IUPAC name is [(R)-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (Z)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [(R)-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (Z)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 129449375 |
| Molecular Formula | C33H48NO5PS |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | [(R)-bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (Z)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OP(=O)(O[C@@H]1C[C@H](C)CC[C@@H]1C(C)C)[C@@H](OC(=O)/C=C\c1cccs1)c1cccnc1 |
| InChI | InChI=1S/C33H48NO5PS/c1-22(2)28-14-11-24(5)19-30(28)38-40(36,39-31-20-25(6)12-15-29(31)23(3)4)33(26-9-7-17-34-21-26)37-32(35)16-13-27-10-8-18-41-27/h7-10,13,16-18,21-25,28-31,33H,11-12,14-15,19-20H2,1-6H3/b16-13-/t24-,25-,28-,29-,30-,31-,33-/m1/s1 |
| InChIKey | WYHWCCCAMNGGIL-HVTHIVLKSA-N |
| XLogP | 9.55 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|