C33H47BrNO6P — CID 6011723
[bis[(2-methyl-5-propan-2-ylcyclohexyl)oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 6011723) has the molecular formula C33H47BrNO6P and a molecular weight of 664.62 g/mol. Its IUPAC name is [bis[(2-methyl-5-propan-2-ylcyclohexyl)oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [bis[(2-methyl-5-propan-2-ylcyclohexyl)oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6011723 |
| Molecular Formula | C33H47BrNO6P |
| Molecular Weight | 664.62 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | [bis[(2-methyl-5-propan-2-ylcyclohexyl)oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CC(C)C1CCC(C)C(OP(=O)(OC2CC(C(C)C)CCC2C)C(OC(=O)/C=C/c2ccc(Br)o2)c2cccnc2)C1 |
| InChI | InChI=1S/C33H47BrNO6P/c1-21(2)25-11-9-23(5)29(18-25)40-42(37,41-30-19-26(22(3)4)12-10-24(30)6)33(27-8-7-17-35-20-27)39-32(36)16-14-28-13-15-31(34)38-28/h7-8,13-17,20-26,29-30,33H,9-12,18-19H2,1-6H3/b16-14+ |
| InChIKey | UZOWBHHDKLOGAM-JQIJEIRASA-N |
| XLogP | 9.84 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.62 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|