C15H14BrNO5 — CID 7868754
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7868754) has the molecular formula C15H14BrNO5 and a molecular weight of 368.18 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7868754 |
| Molecular Formula | C15H14BrNO5 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(Br)o1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H14BrNO5/c1-10(15(19)17-9-12-3-2-8-20-12)21-14(18)7-5-11-4-6-13(16)22-11/h2-8,10H,9H2,1H3,(H,17,19)/b7-5+/t10-/m1/s1 |
| InChIKey | HDZPHRNIXJQQQR-BREXMAIKSA-N |
| XLogP | 2.90 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|