C18H18BrNO5 — CID 7868734
[(2S)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7868734) has the molecular formula C18H18BrNO5 and a molecular weight of 408.25 g/mol. Its IUPAC name is [(2S)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7868734 |
| Molecular Formula | C18H18BrNO5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | [(2S)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | COc1ccc(CNC(=O)[C@H](C)OC(=O)/C=C/c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C18H18BrNO5/c1-12(24-17(21)10-8-15-7-9-16(19)25-15)18(22)20-11-13-3-5-14(23-2)6-4-13/h3-10,12H,11H2,1-2H3,(H,20,22)/b10-8+/t12-/m0/s1 |
| InChIKey | MXHUYIVGXIUIQX-OANVXVOSSA-N |
| XLogP | 3.31 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|