C17H15BrN2O5 — CID 8866726
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 8866726) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8866726 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(Br)o1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15BrN2O5/c1-11(24-15(21)10-8-13-7-9-14(18)25-13)16(22)19-20-17(23)12-5-3-2-4-6-12/h2-11H,1H3,(H,19,22)(H,20,23)/b10-8+/t11-/m0/s1 |
| InChIKey | WOOWCGCMUWWRBF-UQSGXBNBSA-N |
| XLogP | 2.45 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|