C20H21BrO4 — CID 7875194
[(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7875194) has the molecular formula C20H21BrO4 and a molecular weight of 405.29 g/mol. Its IUPAC name is [(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7875194 |
| Molecular Formula | C20H21BrO4 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(Br)o1)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H21BrO4/c1-13(24-18(22)12-10-16-9-11-17(21)25-16)19(23)14-5-7-15(8-6-14)20(2,3)4/h5-13H,1-4H3/b12-10+/t13-/m1/s1 |
| InChIKey | FBACEVWUIRHZHW-RSKUSDAESA-N |
| XLogP | 5.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|