C23H23F3O3 — CID 7355525
[(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7355525) has the molecular formula C23H23F3O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is [(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7355525 |
| Molecular Formula | C23H23F3O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(2R)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(C(F)(F)F)cc1)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H23F3O3/c1-15(21(28)17-8-12-18(13-9-17)22(2,3)4)29-20(27)14-7-16-5-10-19(11-6-16)23(24,25)26/h5-15H,1-4H3/b14-7+/t15-/m1/s1 |
| InChIKey | PBGMIEVXJDCADZ-KEQVLUGWSA-N |
| XLogP | 5.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|