C22H22Cl2O3 — CID 3460107
[1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 3460107) has the molecular formula C22H22Cl2O3 and a molecular weight of 405.32 g/mol. Its IUPAC name is [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3460107 |
| Molecular Formula | C22H22Cl2O3 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccc(Cl)cc1Cl)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H22Cl2O3/c1-14(21(26)16-5-9-17(10-6-16)22(2,3)4)27-20(25)12-8-15-7-11-18(23)13-19(15)24/h5-14H,1-4H3 |
| InChIKey | STVWLCPWXODUDF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|