C21H20Cl2O3 — CID 7873941
[2-(4-tert-butylphenyl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7873941) has the molecular formula C21H20Cl2O3 and a molecular weight of 391.29 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7873941 |
| Molecular Formula | C21H20Cl2O3 |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CC(C)(C)c1ccc(C(=O)COC(=O)/C=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2O3/c1-21(2,3)16-8-4-15(5-9-16)19(24)13-26-20(25)11-7-14-6-10-17(22)12-18(14)23/h4-12H,13H2,1-3H3/b11-7+ |
| InChIKey | XYCFVNXJNIQPON-YRNVUSSQSA-N |
| XLogP | 5.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|