C17H22BrNO4 — CID 98789704
[(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 98789704) has the molecular formula C17H22BrNO4 and a molecular weight of 384.27 g/mol. Its IUPAC name is [(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 98789704 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(Br)o1)C(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C17H22BrNO4/c1-11-5-3-4-6-14(11)19-17(21)12(2)22-16(20)10-8-13-7-9-15(18)23-13/h7-12,14H,3-6H2,1-2H3,(H,19,21)/b10-8+/t11-,12-,14+/m0/s1 |
| InChIKey | FPNMRCDCKBEDQR-PBPLVEGFSA-N |
| XLogP | 3.68 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|