C19H24ClNO3 — CID 8603896
[(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 8603896) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is [(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8603896 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1cccc(Cl)c1)C(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H24ClNO3/c1-13-6-3-4-9-17(13)21-19(23)14(2)24-18(22)11-10-15-7-5-8-16(20)12-15/h5,7-8,10-14,17H,3-4,6,9H2,1-2H3,(H,21,23)/b11-10+/t13-,14+,17+/m0/s1 |
| InChIKey | YUQFBFXMWVMBPU-OFYKVWRASA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|