C19H25NO3 — CID 99005028
[(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 99005028) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 99005028 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [(2S)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccccc1)C(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H25NO3/c1-14-8-6-7-11-17(14)20-19(22)15(2)23-18(21)13-12-16-9-4-3-5-10-16/h3-5,9-10,12-15,17H,6-8,11H2,1-2H3,(H,20,22)/b13-12+/t14-,15-,17+/m0/s1 |
| InChIKey | LGPUFMUNOIMBHS-BSWGFACKSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|