C20H25F2NO4 — CID 7996792
[(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996792) has the molecular formula C20H25F2NO4 and a molecular weight of 381.42 g/mol. Its IUPAC name is [(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996792 |
| Molecular Formula | C20H25F2NO4 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [(2R)-1-[[(1R,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(OC(F)F)cc1)C(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C20H25F2NO4/c1-13-5-3-4-6-17(13)23-19(25)14(2)26-18(24)12-9-15-7-10-16(11-8-15)27-20(21)22/h7-14,17,20H,3-6H2,1-2H3,(H,23,25)/b12-9+/t13-,14+,17+/m0/s1 |
| InChIKey | IXJHTQTWPVQRRS-LPPJGKDHSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|