C35H48Cl2NO5P — CID 129392679
[(S)-bis[[(1R,2S,5R)-2-methyl-5-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 129392679) has the molecular formula C35H48Cl2NO5P and a molecular weight of 664.65 g/mol. Its IUPAC name is [(S)-bis[[(1R,2S,5R)-2-methyl-5-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [(S)-bis[[(1R,2S,5R)-2-methyl-5-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129392679 |
| Molecular Formula | C35H48Cl2NO5P |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | [(S)-bis[[(1R,2S,5R)-2-methyl-5-propan-2-ylcyclohexyl]oxy]phosphoryl-pyridin-3-ylmethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CC(C)[C@@H]1CC[C@H](C)[C@H](OP(=O)(O[C@@H]2C[C@H](C(C)C)CC[C@@H]2C)[C@H](OC(=O)/C=C/c2ccc(Cl)cc2Cl)c2cccnc2)C1 |
| InChI | InChI=1S/C35H48Cl2NO5P/c1-22(2)27-11-9-24(5)32(18-27)42-44(40,43-33-19-28(23(3)4)12-10-25(33)6)35(29-8-7-17-38-21-29)41-34(39)16-14-26-13-15-30(36)20-31(26)37/h7-8,13-17,20-25,27-28,32-33,35H,9-12,18-19H2,1-6H3/b16-14+/t24-,25-,27+,28+,32+,33+,35-/m0/s1 |
| InChIKey | HFBXMBIYRBWBRA-QQHIOQTESA-N |
| XLogP | 10.79 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|