C30H40N3O2P — CID 124719306
4-[[(R)-anilino(pyridin-3-yl)methyl]-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline (PubChem CID 124719306) has the molecular formula C30H40N3O2P and a molecular weight of 505.64 g/mol. Its IUPAC name is 4-[[(R)-anilino(pyridin-3-yl)methyl]-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[(R)-anilino(pyridin-3-yl)methyl]-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 124719306 |
| Molecular Formula | C30H40N3O2P |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 4-[[(R)-anilino(pyridin-3-yl)methyl]-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1O[P@@](=O)(c1ccc(N(C)C)cc1)[C@@H](Nc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C30H40N3O2P/c1-22(2)28-18-13-23(3)20-29(28)35-36(34,27-16-14-26(15-17-27)33(4)5)30(24-10-9-19-31-21-24)32-25-11-7-6-8-12-25/h6-12,14-17,19,21-23,28-30,32H,13,18,20H2,1-5H3/t23-,28-,29-,30-,36+/m1/s1 |
| InChIKey | GQYPRPYTMDPOKN-SSYKQODDSA-N |
| XLogP | 7.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|