C31H41N2O2P — CID 51457900
4-[[(S)-anilino(phenyl)methyl]-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline (PubChem CID 51457900) has the molecular formula C31H41N2O2P and a molecular weight of 504.66 g/mol. Its IUPAC name is 4-[[(S)-anilino(phenyl)methyl]-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[[(S)-anilino(phenyl)methyl]-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 51457900 |
| Molecular Formula | C31H41N2O2P |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 4-[[(S)-anilino(phenyl)methyl]-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]-N,N-dimethylaniline |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@H]1O[P@@](=O)(c1ccc(N(C)C)cc1)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H41N2O2P/c1-23(2)29-21-16-24(3)22-30(29)35-36(34,28-19-17-27(18-20-28)33(4)5)31(25-12-8-6-9-13-25)32-26-14-10-7-11-15-26/h6-15,17-20,23-24,29-32H,16,21-22H2,1-5H3/t24-,29+,30+,31-,36-/m0/s1 |
| InChIKey | JXEZYCKLKRRERQ-VCADJNGVSA-N |
| XLogP | 7.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|