C22H31N2O2P — CID 25358059
N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-pyridin-3-ylmethanamine (PubChem CID 25358059) has the molecular formula C22H31N2O2P and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-pyridin-3-ylmethanamine.
| Compound Name | N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 25358059 |
| Molecular Formula | C22H31N2O2P |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1-pyridin-3-ylmethanamine |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1O[P@@](=O)(NCc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C22H31N2O2P/c1-17(2)21-12-11-18(3)14-22(21)26-27(25,20-9-5-4-6-10-20)24-16-19-8-7-13-23-15-19/h4-10,13,15,17-18,21-22H,11-12,14,16H2,1-3H3,(H,24,25)/t18-,21-,22+,27-/m1/s1 |
| InChIKey | ZAZVYWABHTXZML-RISAILHGSA-N |
| XLogP | 5.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|