C38H52O6P2 — CID 102226548
1,4-bis[[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxy]benzene (PubChem CID 102226548) has the molecular formula C38H52O6P2 and a molecular weight of 666.78 g/mol. Its IUPAC name is 1,4-bis[[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxy]benzene.
| Compound Name | 1,4-bis[[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxy]benzene |
|---|---|
| PubChem CID | 102226548 |
| Molecular Formula | C38H52O6P2 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | 1,4-bis[[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]oxy]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OP(=O)(Oc1ccc(OP(=O)(O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H52O6P2/c1-27(2)35-23-17-29(5)25-37(35)43-45(39,33-13-9-7-10-14-33)41-31-19-21-32(22-20-31)42-46(40,34-15-11-8-12-16-34)44-38-26-30(6)18-24-36(38)28(3)4/h7-16,19-22,27-30,35-38H,17-18,23-26H2,1-6H3/t29-,30-,35+,36+,37-,38-,45?,46?/m1/s1 |
| InChIKey | MRZDDVOZZHDLNG-CABDCMTHSA-N |
| XLogP | 10.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|