C22H35O2P — CID 139080801
[cyclohexyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene (PubChem CID 139080801) has the molecular formula C22H35O2P and a molecular weight of 362.49 g/mol. Its IUPAC name is [cyclohexyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene.
| Compound Name | [cyclohexyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene |
|---|---|
| PubChem CID | 139080801 |
| Molecular Formula | C22H35O2P |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | [cyclohexyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]benzene |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[P@](=O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H35O2P/c1-17(2)21-15-14-18(3)16-22(21)24-25(23,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4,6-7,10-11,17-18,20-22H,5,8-9,12-16H2,1-3H3/t18-,21+,22-,25-/m1/s1 |
| InChIKey | ZKLTZXOMXBXGHF-LALUYCJQSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|