C20H34NO2P — CID 11899942
2-methyl-N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine (PubChem CID 11899942) has the molecular formula C20H34NO2P and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-methyl-N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine.
| Compound Name | 2-methyl-N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 11899942 |
| Molecular Formula | C20H34NO2P |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-methyl-N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]propan-2-amine |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1O[P@](=O)(NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H34NO2P/c1-15(2)18-13-12-16(3)14-19(18)23-24(22,21-20(4,5)6)17-10-8-7-9-11-17/h7-11,15-16,18-19H,12-14H2,1-6H3,(H,21,22)/t16-,18-,19-,24+/m1/s1 |
| InChIKey | DAJGFDWVRFTHOQ-JQGROFRJSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|