C21H29N2O2P — CID 129470795
N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]pyridin-2-amine (PubChem CID 129470795) has the molecular formula C21H29N2O2P and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]pyridin-2-amine.
| Compound Name | N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]pyridin-2-amine |
|---|---|
| PubChem CID | 129470795 |
| Molecular Formula | C21H29N2O2P |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]pyridin-2-amine |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1O[P@@](=O)(Nc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C21H29N2O2P/c1-16(2)19-13-12-17(3)15-20(19)25-26(24,18-9-5-4-6-10-18)23-21-11-7-8-14-22-21/h4-11,14,16-17,19-20H,12-13,15H2,1-3H3,(H,22,23,24)/t17-,19-,20-,26-/m1/s1 |
| InChIKey | ZOUQTPPIGLPWOG-REMZYBCOSA-N |
| XLogP | 5.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|