C19H27N2O2PS — CID 11914617
N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1,3-thiazol-2-amine (PubChem CID 11914617) has the molecular formula C19H27N2O2PS and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1,3-thiazol-2-amine.
| Compound Name | N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 11914617 |
| Molecular Formula | C19H27N2O2PS |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]-1,3-thiazol-2-amine |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[P@](=O)(Nc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C19H27N2O2PS/c1-14(2)17-10-9-15(3)13-18(17)23-24(22,16-7-5-4-6-8-16)21-19-20-11-12-25-19/h4-8,11-12,14-15,17-18H,9-10,13H2,1-3H3,(H,20,21,22)/t15-,17+,18-,24+/m1/s1 |
| InChIKey | UYVHGVYNQZTQAH-ANUWBGAGSA-N |
| XLogP | 5.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|